C28H21N3O5 — CID 124791331
methyl (1S,2S,3R,3aS)-1-benzoyl-3-cyano-2-(4-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate (PubChem CID 124791331) has the molecular formula C28H21N3O5 and a molecular weight of 479.49 g/mol. Its IUPAC name is methyl (1S,2S,3R,3aS)-1-benzoyl-3-cyano-2-(4-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate.
| Compound Name | methyl (1S,2S,3R,3aS)-1-benzoyl-3-cyano-2-(4-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 124791331 |
| Molecular Formula | C28H21N3O5 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | methyl (1S,2S,3R,3aS)-1-benzoyl-3-cyano-2-(4-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate |
| SMILES | COC(=O)[C@]1(C#N)[C@H](c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)c2ccccc2)N2c3ccccc3C=C[C@H]21 |
| InChI | InChI=1S/C28H21N3O5/c1-36-27(33)28(17-29)23-16-13-18-7-5-6-10-22(18)30(23)25(26(32)20-8-3-2-4-9-20)24(28)19-11-14-21(15-12-19)31(34)35/h2-16,23-25H,1H3/t23-,24+,25-,28-/m0/s1 |
| InChIKey | PJPFYYLRXGXFRX-GIBNYFNHSA-N |
| XLogP | 4.53 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|