C30H25N3O7 — CID 98457190
methyl (1R,2R,3S,3aR)-3-cyano-2-(3,4-dimethoxyphenyl)-1-(3-nitrobenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate (PubChem CID 98457190) has the molecular formula C30H25N3O7 and a molecular weight of 539.54 g/mol. Its IUPAC name is methyl (1R,2R,3S,3aR)-3-cyano-2-(3,4-dimethoxyphenyl)-1-(3-nitrobenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate.
| Compound Name | methyl (1R,2R,3S,3aR)-3-cyano-2-(3,4-dimethoxyphenyl)-1-(3-nitrobenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98457190 |
| Molecular Formula | C30H25N3O7 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | methyl (1R,2R,3S,3aR)-3-cyano-2-(3,4-dimethoxyphenyl)-1-(3-nitrobenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C#N)[C@@H](c2ccc(OC)c(OC)c2)[C@H](C(=O)c2cccc([N+](=O)[O-])c2)N2c3ccccc3C=C[C@@H]21 |
| InChI | InChI=1S/C30H25N3O7/c1-38-23-13-11-19(16-24(23)39-2)26-27(28(34)20-8-6-9-21(15-20)33(36)37)32-22-10-5-4-7-18(22)12-14-25(32)30(26,17-31)29(35)40-3/h4-16,25-27H,1-3H3/t25-,26+,27-,30-/m1/s1 |
| InChIKey | RZBCFKXJEQWHAQ-UUROJUAVSA-N |
| XLogP | 4.55 |
| TPSA | 132.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|