C22H28N2O4 — CID 124791762
(1'S,2R,4'R,5'R)-5'-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one (PubChem CID 124791762) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (1'S,2R,4'R,5'R)-5'-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one.
| Compound Name | (1'S,2R,4'R,5'R)-5'-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one |
|---|---|
| PubChem CID | 124791762 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (1'S,2R,4'R,5'R)-5'-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one |
| SMILES | O=C1N[C@]2(C[C@H]3CC[C@H]2C[C@H]3C(=O)N2CCC[C@@H](CO)C2)Oc2ccccc21 |
| InChI | InChI=1S/C22H28N2O4/c25-13-14-4-3-9-24(12-14)21(27)18-10-16-8-7-15(18)11-22(16)23-20(26)17-5-1-2-6-19(17)28-22/h1-2,5-6,14-16,18,25H,3-4,7-13H2,(H,23,26)/t14-,15-,16+,18-,22-/m1/s1 |
| InChIKey | HUYHDPLYJUOAJW-DYIOZPFISA-N |
| XLogP | 2.17 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |