C21H26N2O4 — CID 98069450
(1'R,2R,4'S,5'S)-5'-[(3S)-3-hydroxypiperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one (PubChem CID 98069450) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1'R,2R,4'S,5'S)-5'-[(3S)-3-hydroxypiperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one.
| Compound Name | (1'R,2R,4'S,5'S)-5'-[(3S)-3-hydroxypiperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one |
|---|---|
| PubChem CID | 98069450 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1'R,2R,4'S,5'S)-5'-[(3S)-3-hydroxypiperidine-1-carbonyl]spiro[3H-1,3-benzoxazine-2,2'-bicyclo[2.2.2]octane]-4-one |
| SMILES | O=C1N[C@]2(C[C@@H]3CC[C@@H]2C[C@@H]3C(=O)N2CCC[C@H](O)C2)Oc2ccccc21 |
| InChI | InChI=1S/C21H26N2O4/c24-15-4-3-9-23(12-15)20(26)17-10-14-8-7-13(17)11-21(14)22-19(25)16-5-1-2-6-18(16)27-21/h1-2,5-6,13-15,17,24H,3-4,7-12H2,(H,22,25)/t13-,14+,15-,17-,21+/m0/s1 |
| InChIKey | IGNOGTUSSJKHTN-RUPGSYKBSA-N |
| XLogP | 1.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |