C19H25N3O2S — CID 124794352
(4aR,6S,7aS)-6-[(6-methyl-2-pyridinyl)methoxymethyl]-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 124794352) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is (4aR,6S,7aS)-6-[(6-methyl-2-pyridinyl)methoxymethyl]-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,6S,7aS)-6-[(6-methyl-2-pyridinyl)methoxymethyl]-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124794352 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (4aR,6S,7aS)-6-[(6-methyl-2-pyridinyl)methoxymethyl]-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Cc1cccc(COC[C@@H]2C[C@@H]3OCCN(Cc4nccs4)[C@@H]3C2)n1 |
| InChI | InChI=1S/C19H25N3O2S/c1-14-3-2-4-16(21-14)13-23-12-15-9-17-18(10-15)24-7-6-22(17)11-19-20-5-8-25-19/h2-5,8,15,17-18H,6-7,9-13H2,1H3/t15-,17+,18-/m0/s1 |
| InChIKey | LVWOCJYRYDTQHC-JQHSSLGASA-N |
| XLogP | 3.04 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |