C18H22N2O2S — CID 97378210
(4aR,6S,7aR)-6-(pyridin-2-yloxymethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97378210) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is (4aR,6S,7aR)-6-(pyridin-2-yloxymethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,6S,7aR)-6-(pyridin-2-yloxymethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97378210 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (4aR,6S,7aR)-6-(pyridin-2-yloxymethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | c1ccc(OC[C@H]2C[C@@H]3[C@@H](C2)OCCN3Cc2cccs2)nc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-2-6-19-18(5-1)22-13-14-10-16-17(11-14)21-8-7-20(16)12-15-4-3-9-23-15/h1-6,9,14,16-17H,7-8,10-13H2/t14-,16+,17+/m0/s1 |
| InChIKey | HTFXWPNKDZRIQQ-USXIJHARSA-N |
| XLogP | 3.20 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |