C19H23ClN4O2 — CID 171678567
(4aS,6S,7aR)-4-(2-chloro-5-ethylpyrimidin-4-yl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 171678567) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is (4aS,6S,7aR)-4-(2-chloro-5-ethylpyrimidin-4-yl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,6S,7aR)-4-(2-chloro-5-ethylpyrimidin-4-yl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 171678567 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (4aS,6S,7aR)-4-(2-chloro-5-ethylpyrimidin-4-yl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | CCc1cnc(Cl)nc1N1CCO[C@@H]2C[C@@H](COc3ccccn3)C[C@@H]21 |
| InChI | InChI=1S/C19H23ClN4O2/c1-2-14-11-22-19(20)23-18(14)24-7-8-25-16-10-13(9-15(16)24)12-26-17-5-3-4-6-21-17/h3-6,11,13,15-16H,2,7-10,12H2,1H3/t13-,15-,16+/m0/s1 |
| InChIKey | VICSTODRNQRNDX-CWRNSKLLSA-N |
| XLogP | 3.15 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |