C19H22F6N2O8 — CID 155834701
2-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155834701) has the molecular formula C19H22F6N2O8 and a molecular weight of 520.38 g/mol. Its IUPAC name is 2-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155834701 |
| Molecular Formula | C19H22F6N2O8 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 2-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]acetic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)CN1CCOC2CC(COc3ccccn3)CC21 |
| InChI | InChI=1S/C15H20N2O4.2C2HF3O2/c18-15(19)9-17-5-6-20-13-8-11(7-12(13)17)10-21-14-3-1-2-4-16-14;2*3-2(4,5)1(6)7/h1-4,11-13H,5-10H2,(H,18,19);2*(H,6,7) |
| InChIKey | CQDBURDMAMUDAR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |