C20H28F3N3O5 — CID 171694686
N,N-dimethyl-2-[[4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 171694686) has the molecular formula C20H28F3N3O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[[4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694686 |
| Molecular Formula | C20H28F3N3O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N,N-dimethyl-2-[[4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COCC1CC2OCCN(Cc3ccccn3)C2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O3.C2HF3O2/c1-20(2)18(22)13-23-12-14-9-16-17(10-14)24-8-7-21(16)11-15-5-3-4-6-19-15;3-2(4,5)1(6)7/h3-6,14,16-17H,7-13H2,1-2H3;(H,6,7) |
| InChIKey | CZKOHRMTKRBJMX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |