C21H29F3N2O6 — CID 155855617
2-[[4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155855617) has the molecular formula C21H29F3N2O6 and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855617 |
| Molecular Formula | C21H29F3N2O6 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(COCC1CC2OCCN(Cc3ccco3)C2C1)N1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N2O4.C2HF3O2/c22-19(20-5-1-2-6-20)14-23-13-15-10-17-18(11-15)25-9-7-21(17)12-16-4-3-8-24-16;3-2(4,5)1(6)7/h3-4,8,15,17-18H,1-2,5-7,9-14H2;(H,6,7) |
| InChIKey | QUBRMVVILOJBSH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |