C22H24F6N2O7 — CID 127022679
(4aR,7aR)-4-(furan-3-ylmethyl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022679) has the molecular formula C22H24F6N2O7 and a molecular weight of 542.43 g/mol. Its IUPAC name is (4aR,7aR)-4-(furan-3-ylmethyl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aR,7aR)-4-(furan-3-ylmethyl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022679 |
| Molecular Formula | C22H24F6N2O7 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (4aR,7aR)-4-(furan-3-ylmethyl)-6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(OCC2C[C@@H]3[C@@H](C2)OCCN3Cc2ccoc2)nc1 |
| InChI | InChI=1S/C18H22N2O3.2C2HF3O2/c1-2-5-19-18(3-1)23-13-15-9-16-17(10-15)22-8-6-20(16)11-14-4-7-21-12-14;2*3-2(4,5)1(6)7/h1-5,7,12,15-17H,6,8-11,13H2;2*(H,6,7)/t15?,16-,17-;;/m1../s1 |
| InChIKey | AZIFZHHCUAPMDR-XDKUFTMDSA-N |
| XLogP | 4.00 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |