C21H23F3N2O5S — CID 155856702
1-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155856702) has the molecular formula C21H23F3N2O5S and a molecular weight of 472.49 g/mol. Its IUPAC name is 1-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155856702 |
| Molecular Formula | C21H23F3N2O5S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-[6-(pyridin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1cccs1)N1CCOC2CC(COc3ccccn3)CC21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N2O3S.C2HF3O2/c22-19(12-15-4-3-9-25-15)21-7-8-23-17-11-14(10-16(17)21)13-24-18-5-1-2-6-20-18;3-2(4,5)1(6)7/h1-6,9,14,16-17H,7-8,10-13H2;(H,6,7) |
| InChIKey | VFVNTGZQLJSEEK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |