C22H27F6N3O6S — CID 155838244
7-(furan-2-ylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155838244) has the molecular formula C22H27F6N3O6S and a molecular weight of 575.53 g/mol. Its IUPAC name is 7-(furan-2-ylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(furan-2-ylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155838244 |
| Molecular Formula | C22H27F6N3O6S |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 7-(furan-2-ylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCOC3CCN(Cc4ccco4)CCC32)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N3O2S.2C2HF3O2/c1-14-19-15(13-24-14)11-21-8-10-23-18-5-7-20(6-4-17(18)21)12-16-3-2-9-22-16;2*3-2(4,5)1(6)7/h2-3,9,13,17-18H,4-8,10-12H2,1H3;2*(H,6,7) |
| InChIKey | HFWSQONMBCGIRZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |