C19H26F3N3O4S — CID 155824012
(3aS,4R,7aS)-N-cyclobutyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155824012) has the molecular formula C19H26F3N3O4S and a molecular weight of 449.50 g/mol. Its IUPAC name is (3aS,4R,7aS)-N-cyclobutyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,4R,7aS)-N-cyclobutyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824012 |
| Molecular Formula | C19H26F3N3O4S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3aS,4R,7aS)-N-cyclobutyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C[C@H](C(=O)NC3CCC3)[C@@H]3CCO[C@@H]3C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O2S.C2HF3O2/c1-11-18-13(10-23-11)7-20-8-15(14-5-6-22-16(14)9-20)17(21)19-12-3-2-4-12;3-2(4,5)1(6)7/h10,12,14-16H,2-9H2,1H3,(H,19,21);(H,6,7)/t14-,15-,16+;/m0./s1 |
| InChIKey | CZEUORUZYHFAKC-MLZPLGHASA-N |
| XLogP | 2.59 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |