C17H26N2O2 — CID 98778940
(4aR,9aS)-4-(cyclopropylmethyl)-7-(furan-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine (PubChem CID 98778940) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (4aR,9aS)-4-(cyclopropylmethyl)-7-(furan-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine.
| Compound Name | (4aR,9aS)-4-(cyclopropylmethyl)-7-(furan-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine |
|---|---|
| PubChem CID | 98778940 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (4aR,9aS)-4-(cyclopropylmethyl)-7-(furan-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine |
| SMILES | c1coc(CN2CC[C@@H]3OCCN(CC4CC4)[C@@H]3CC2)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-2-15(20-10-1)13-18-7-5-16-17(6-8-18)21-11-9-19(16)12-14-3-4-14/h1-2,10,14,16-17H,3-9,11-13H2/t16-,17+/m1/s1 |
| InChIKey | OXKNUNVMFCNJIV-SJORKVTESA-N |
| XLogP | 2.35 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |