C21H30F6N4O5 — CID 155855425
4-(cyclopropylmethyl)-7-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155855425) has the molecular formula C21H30F6N4O5 and a molecular weight of 532.48 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-7-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(cyclopropylmethyl)-7-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155855425 |
| Molecular Formula | C21H30F6N4O5 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 4-(cyclopropylmethyl)-7-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1ccnc1CN1CCC2OCCN(CC3CC3)C2CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N4O.2C2HF3O2/c1-19-9-6-18-17(19)13-20-7-4-15-16(5-8-20)22-11-10-21(15)12-14-2-3-14;2*3-2(4,5)1(6)7/h6,9,14-16H,2-5,7-8,10-13H2,1H3;2*(H,6,7) |
| InChIKey | HXPBDARMQXOFIG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |