C18H28N2OS — CID 131645182
4-(cyclopropylmethyl)-7-[(5-methylthiophen-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine (PubChem CID 131645182) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-7-[(5-methylthiophen-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine.
| Compound Name | 4-(cyclopropylmethyl)-7-[(5-methylthiophen-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine |
|---|---|
| PubChem CID | 131645182 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-(cyclopropylmethyl)-7-[(5-methylthiophen-2-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine |
| SMILES | Cc1ccc(CN2CCC3OCCN(CC4CC4)C3CC2)s1 |
| InChI | InChI=1S/C18H28N2OS/c1-14-2-5-16(22-14)13-19-8-6-17-18(7-9-19)21-11-10-20(17)12-15-3-4-15/h2,5,15,17-18H,3-4,6-13H2,1H3 |
| InChIKey | BIMIPXCXRUOKAD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |