C17H29N3OS — CID 131660761
N,N-dimethyl-2-[7-(thiophen-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanamine (PubChem CID 131660761) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[7-(thiophen-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[7-(thiophen-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanamine |
|---|---|
| PubChem CID | 131660761 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N,N-dimethyl-2-[7-(thiophen-2-ylmethyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanamine |
| SMILES | CN(C)CCN1CCOC2CCN(Cc3cccs3)CCC21 |
| InChI | InChI=1S/C17H29N3OS/c1-18(2)9-10-20-11-12-21-17-6-8-19(7-5-16(17)20)14-15-4-3-13-22-15/h3-4,13,16-17H,5-12,14H2,1-2H3 |
| InChIKey | YGYJZNXSFYERDM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |