C16H27N5O2 — CID 124801162
[(4aR,9aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 124801162) has the molecular formula C16H27N5O2 and a molecular weight of 321.42 g/mol. Its IUPAC name is [(4aR,9aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(4aR,9aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 124801162 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | [(4aR,9aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CN(C)CCN1CCO[C@H]2CCN(C(=O)c3ccn[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C16H27N5O2/c1-19(2)9-10-20-11-12-23-15-5-8-21(7-4-14(15)20)16(22)13-3-6-17-18-13/h3,6,14-15H,4-5,7-12H2,1-2H3,(H,17,18)/t14-,15+/m1/s1 |
| InChIKey | BCMPYLDEQWLUQO-CABCVRRESA-N |
| XLogP | 0.28 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |