C17H28N4O2 — CID 124803603
[(4aR,9aR)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 124803603) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is [(4aR,9aR)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(4aR,9aR)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 124803603 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | [(4aR,9aR)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CN(C)CCN1CCO[C@@H]2CCN(C(=O)c3ccc[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C17H28N4O2/c1-19(2)10-11-20-12-13-23-16-6-9-21(8-5-15(16)20)17(22)14-4-3-7-18-14/h3-4,7,15-16,18H,5-6,8-13H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | GHWSSYHBBSJLMA-HZPDHXFCSA-N |
| XLogP | 0.88 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |