C21H27N3O4S — CID 134690500
[(1S,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 134690500) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is [(1S,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(1S,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 134690500 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [(1S,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CC(C)CN1[C@@H]2CCN(C(=O)c3ccc[nH]3)CC[C@@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H27N3O4S/c1-15(2)14-24-17-9-12-23(21(25)16-6-5-11-22-16)13-10-18(17)28-19-7-3-4-8-20(19)29(24,26)27/h3-8,11,15,17-18,22H,9-10,12-14H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | CUCAGIZKRDYANQ-MSOLQXFVSA-N |
| XLogP | 2.73 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |