C18H28N2O5S — CID 124796362
(1R,11R)-10,14-bis(2-methoxyethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide (PubChem CID 124796362) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is (1R,11R)-10,14-bis(2-methoxyethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide.
| Compound Name | (1R,11R)-10,14-bis(2-methoxyethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 124796362 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (1R,11R)-10,14-bis(2-methoxyethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
| SMILES | COCCN1CC[C@@H]2[C@@H](CC1)Oc1ccccc1S(=O)(=O)N2CCOC |
| InChI | InChI=1S/C18H28N2O5S/c1-23-13-11-19-9-7-15-16(8-10-19)25-17-5-3-4-6-18(17)26(21,22)20(15)12-14-24-2/h3-6,15-16H,7-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | SIKVDTDCDRRAHB-HZPDHXFCSA-N |
| XLogP | 1.20 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |