C23H31N3O3S — CID 124825842
(1R,11R)-10-(3-methylbutyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide (PubChem CID 124825842) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is (1R,11R)-10-(3-methylbutyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide.
| Compound Name | (1R,11R)-10-(3-methylbutyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 124825842 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (1R,11R)-10-(3-methylbutyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
| SMILES | CC(C)CCN1[C@@H]2CCN(Cc3ccccn3)CC[C@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C23H31N3O3S/c1-18(2)10-16-26-20-11-14-25(17-19-7-5-6-13-24-19)15-12-21(20)29-22-8-3-4-9-23(22)30(26,27)28/h3-9,13,18,20-21H,10-12,14-17H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | PPQQKRYNRYWATQ-NHCUHLMSSA-N |
| XLogP | 3.54 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |