C21H27N3O4S — CID 124790396
(1R,11R)-10-(2-methoxyethyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide (PubChem CID 124790396) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is (1R,11R)-10-(2-methoxyethyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide.
| Compound Name | (1R,11R)-10-(2-methoxyethyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 124790396 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (1R,11R)-10-(2-methoxyethyl)-14-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
| SMILES | COCCN1[C@@H]2CCN(Cc3ccccn3)CC[C@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H27N3O4S/c1-27-15-14-24-18-9-12-23(16-17-6-4-5-11-22-17)13-10-19(18)28-20-7-2-3-8-21(20)29(24,25)26/h2-8,11,18-19H,9-10,12-16H2,1H3/t18-,19-/m1/s1 |
| InChIKey | IRRRLZDXGRCKGL-RTBURBONSA-N |
| XLogP | 2.14 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |