C21H25FN2O3S — CID 124831103
(1R,11R)-10-ethyl-14-[(2-fluorophenyl)methyl]-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide (PubChem CID 124831103) has the molecular formula C21H25FN2O3S and a molecular weight of 404.51 g/mol. Its IUPAC name is (1R,11R)-10-ethyl-14-[(2-fluorophenyl)methyl]-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide.
| Compound Name | (1R,11R)-10-ethyl-14-[(2-fluorophenyl)methyl]-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 124831103 |
| Molecular Formula | C21H25FN2O3S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (1R,11R)-10-ethyl-14-[(2-fluorophenyl)methyl]-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
| SMILES | CCN1[C@@H]2CCN(Cc3ccccc3F)CC[C@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H25FN2O3S/c1-2-24-18-11-13-23(15-16-7-3-4-8-17(16)22)14-12-19(18)27-20-9-5-6-10-21(20)28(24,25)26/h3-10,18-19H,2,11-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | MMCVLANMHOZYOF-RTBURBONSA-N |
| XLogP | 3.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |