C20H25FN4O3S — CID 125255467
(1S,11R)-14-(5-fluoropyrimidin-2-yl)-10-(2-methylpropyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide (PubChem CID 125255467) has the molecular formula C20H25FN4O3S and a molecular weight of 420.51 g/mol. Its IUPAC name is (1S,11R)-14-(5-fluoropyrimidin-2-yl)-10-(2-methylpropyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide.
| Compound Name | (1S,11R)-14-(5-fluoropyrimidin-2-yl)-10-(2-methylpropyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 125255467 |
| Molecular Formula | C20H25FN4O3S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (1S,11R)-14-(5-fluoropyrimidin-2-yl)-10-(2-methylpropyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide |
| SMILES | CC(C)CN1[C@@H]2CCN(c3ncc(F)cn3)CC[C@@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H25FN4O3S/c1-14(2)13-25-16-7-9-24(20-22-11-15(21)12-23-20)10-8-17(16)28-18-5-3-4-6-19(18)29(25,26)27/h3-6,11-12,14,16-17H,7-10,13H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | FBZNJBFLMOGHQP-SJORKVTESA-N |
| XLogP | 2.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |