C20H25N5O4S — CID 134690439
2-[(1S,11R)-9,9-dioxo-14-pyrimidin-2-yl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-10-yl]-N,N-dimethylacetamide (PubChem CID 134690439) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-[(1S,11R)-9,9-dioxo-14-pyrimidin-2-yl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-10-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1S,11R)-9,9-dioxo-14-pyrimidin-2-yl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-10-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 134690439 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[(1S,11R)-9,9-dioxo-14-pyrimidin-2-yl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-10-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1[C@@H]2CCN(c3ncccn3)CC[C@@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H25N5O4S/c1-23(2)19(26)14-25-15-8-12-24(20-21-10-5-11-22-20)13-9-16(15)29-17-6-3-4-7-18(17)30(25,27)28/h3-7,10-11,15-16H,8-9,12-14H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | HHOFHCVSWCJPAE-CVEARBPZSA-N |
| XLogP | 0.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |