C21H27N5O4S — CID 124810427
[(1R,11R)-10-[2-(dimethylamino)ethyl]-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-pyrazin-2-ylmethanone (PubChem CID 124810427) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is [(1R,11R)-10-[2-(dimethylamino)ethyl]-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(1R,11R)-10-[2-(dimethylamino)ethyl]-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124810427 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [(1R,11R)-10-[2-(dimethylamino)ethyl]-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-pyrazin-2-ylmethanone |
| SMILES | CN(C)CCN1[C@@H]2CCN(C(=O)c3cnccn3)CC[C@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H27N5O4S/c1-24(2)13-14-26-17-7-11-25(21(27)16-15-22-9-10-23-16)12-8-18(17)30-19-5-3-4-6-20(19)31(26,28)29/h3-6,9-10,15,17-18H,7-8,11-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | VJZJXNVFGTXRFL-QZTJIDSGSA-N |
| XLogP | 1.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |