C23H27N3O4S — CID 97441405
2-cyclopropyl-1-[(1S,11S)-9,9-dioxo-10-(pyridin-3-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]ethanone (PubChem CID 97441405) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(1S,11S)-9,9-dioxo-10-(pyridin-3-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]ethanone.
| Compound Name | 2-cyclopropyl-1-[(1S,11S)-9,9-dioxo-10-(pyridin-3-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]ethanone |
|---|---|
| PubChem CID | 97441405 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-cyclopropyl-1-[(1S,11S)-9,9-dioxo-10-(pyridin-3-ylmethyl)-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]ethanone |
| SMILES | O=C(CC1CC1)N1CC[C@@H]2Oc3ccccc3S(=O)(=O)N(Cc3cccnc3)[C@H]2CC1 |
| InChI | InChI=1S/C23H27N3O4S/c27-23(14-17-7-8-17)25-12-9-19-20(10-13-25)30-21-5-1-2-6-22(21)31(28,29)26(19)16-18-4-3-11-24-15-18/h1-6,11,15,17,19-20H,7-10,12-14,16H2/t19-,20-/m0/s1 |
| InChIKey | VPJLNPZBGNWBEW-PMACEKPBSA-N |
| XLogP | 2.82 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |