C21H24ClN3O4S — CID 97441251
(1S,11S)-N-(2-chlorophenyl)-10-ethyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide (PubChem CID 97441251) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is (1S,11S)-N-(2-chlorophenyl)-10-ethyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide.
| Compound Name | (1S,11S)-N-(2-chlorophenyl)-10-ethyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide |
|---|---|
| PubChem CID | 97441251 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (1S,11S)-N-(2-chlorophenyl)-10-ethyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide |
| SMILES | CCN1[C@H]2CCN(C(=O)Nc3ccccc3Cl)CC[C@@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H24ClN3O4S/c1-2-25-17-11-13-24(21(26)23-16-8-4-3-7-15(16)22)14-12-18(17)29-19-9-5-6-10-20(19)30(25,27)28/h3-10,17-18H,2,11-14H2,1H3,(H,23,26)/t17-,18-/m0/s1 |
| InChIKey | KSKNVDTVEMYJNJ-ROUUACIJSA-N |
| XLogP | 3.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |