C20H22ClN3O4S — CID 155901323
(1S,11S)-N-(2-chlorophenyl)-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide (PubChem CID 155901323) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is (1S,11S)-N-(2-chlorophenyl)-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide.
| Compound Name | (1S,11S)-N-(2-chlorophenyl)-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide |
|---|---|
| PubChem CID | 155901323 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (1S,11S)-N-(2-chlorophenyl)-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide |
| SMILES | CN1[C@H]2CCN(C(=O)Nc3ccccc3Cl)CC[C@@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H22ClN3O4S/c1-23-16-10-12-24(20(25)22-15-7-3-2-6-14(15)21)13-11-17(16)28-18-8-4-5-9-19(18)29(23,26)27/h2-9,16-17H,10-13H2,1H3,(H,22,25)/t16-,17-/m0/s1 |
| InChIKey | HNBNOZKAJMOQFQ-IRXDYDNUSA-N |
| XLogP | 3.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |