C21H28N2O5S — CID 124786950
[(1R,11R)-10-(cyclopropylmethyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 124786950) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is [(1R,11R)-10-(cyclopropylmethyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [(1R,11R)-10-(cyclopropylmethyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 124786950 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(1R,11R)-10-(cyclopropylmethyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CC[C@@H]2[C@@H](CC1)Oc1ccccc1S(=O)(=O)N2CC1CC1 |
| InChI | InChI=1S/C21H28N2O5S/c24-21(19-5-3-13-27-19)22-11-9-16-17(10-12-22)28-18-4-1-2-6-20(18)29(25,26)23(16)14-15-7-8-15/h1-2,4,6,15-17,19H,3,5,7-14H2/t16-,17-,19+/m1/s1 |
| InChIKey | GBRYKVSVAXREAK-LMMKCTJWSA-N |
| XLogP | 2.02 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |