C22H29N3O4S — CID 124821294
[(1R,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1-methylpyrrol-2-yl)methanone (PubChem CID 124821294) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is [(1R,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1-methylpyrrol-2-yl)methanone.
| Compound Name | [(1R,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1-methylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 124821294 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [(1R,11R)-10-(2-methylpropyl)-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-trien-14-yl]-(1-methylpyrrol-2-yl)methanone |
| SMILES | CC(C)CN1[C@@H]2CCN(C(=O)c3cccn3C)CC[C@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C22H29N3O4S/c1-16(2)15-25-17-10-13-24(22(26)18-7-6-12-23(18)3)14-11-19(17)29-20-8-4-5-9-21(20)30(25,27)28/h4-9,12,16-17,19H,10-11,13-15H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | WHEMFYXCHWYIPR-IEBWSBKVSA-N |
| XLogP | 2.74 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |