C16H26N4O — CID 97460075
[(2S,3aR,7aS)-2-[(dimethylamino)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 97460075) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is [(2S,3aR,7aS)-2-[(dimethylamino)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(2S,3aR,7aS)-2-[(dimethylamino)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 97460075 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(2S,3aR,7aS)-2-[(dimethylamino)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CN(C)C[C@@H]1C[C@@H]2CN(C(=O)c3ccc[nH]3)CC[C@@H]2N1C |
| InChI | InChI=1S/C16H26N4O/c1-18(2)11-13-9-12-10-20(8-6-15(12)19(13)3)16(21)14-5-4-7-17-14/h4-5,7,12-13,15,17H,6,8-11H2,1-3H3/t12-,13+,15+/m1/s1 |
| InChIKey | NYCMELLRCVPEDZ-IPYPFGDCSA-N |
| XLogP | 1.11 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |