C17H22N6O — CID 133140914
[(2R,3aS,7aR)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone (PubChem CID 133140914) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is [(2R,3aS,7aR)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone.
| Compound Name | [(2R,3aS,7aR)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 133140914 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(2R,3aS,7aR)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone |
| SMILES | CN1[C@@H](Cn2cncn2)C[C@H]2CN(C(=O)c3ccccn3)CC[C@H]21 |
| InChI | InChI=1S/C17H22N6O/c1-21-14(10-23-12-18-11-20-23)8-13-9-22(7-5-16(13)21)17(24)15-4-2-3-6-19-15/h2-4,6,11-14,16H,5,7-10H2,1H3/t13-,14+,16+/m0/s1 |
| InChIKey | JEYGIVVOUZVTIG-SQWLQELKSA-N |
| XLogP | 0.91 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |