C19H24N6O3 — CID 131683549
6-[(2S,3aR,7aS)-1-acetyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-5-carbonyl]-1-methylpyridin-2-one (PubChem CID 131683549) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-[(2S,3aR,7aS)-1-acetyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-5-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 6-[(2S,3aR,7aS)-1-acetyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-5-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 131683549 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 6-[(2S,3aR,7aS)-1-acetyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-5-carbonyl]-1-methylpyridin-2-one |
| SMILES | CC(=O)N1[C@H](Cn2cncn2)C[C@@H]2CN(C(=O)c3cccc(=O)n3C)CC[C@@H]21 |
| InChI | InChI=1S/C19H24N6O3/c1-13(26)25-15(10-24-12-20-11-21-24)8-14-9-23(7-6-16(14)25)19(28)17-4-3-5-18(27)22(17)2/h3-5,11-12,14-16H,6-10H2,1-2H3/t14-,15+,16+/m1/s1 |
| InChIKey | XHPQZYKZHATENU-PMPSAXMXSA-N |
| XLogP | 0.13 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |