C17H23N7O — CID 97386844
1-[(2S,3aR,7aS)-5-(6-methylpyridazin-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 97386844) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-5-(6-methylpyridazin-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(2S,3aR,7aS)-5-(6-methylpyridazin-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 97386844 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-[(2S,3aR,7aS)-5-(6-methylpyridazin-3-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H](Cn2cncn2)C[C@@H]2CN(c3ccc(C)nn3)CC[C@@H]21 |
| InChI | InChI=1S/C17H23N7O/c1-12-3-4-17(21-20-12)22-6-5-16-14(8-22)7-15(24(16)13(2)25)9-23-11-18-10-19-23/h3-4,10-11,14-16H,5-9H2,1-2H3/t14-,15+,16+/m1/s1 |
| InChIKey | GPTQXWKMGNAJGP-PMPSAXMXSA-N |
| XLogP | 0.89 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |