C18H23N5O — CID 97460139
[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-phenylmethanone (PubChem CID 97460139) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is [(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-phenylmethanone.
| Compound Name | [(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 97460139 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-phenylmethanone |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN(C(=O)c3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C18H23N5O/c1-21-16(11-23-13-19-12-20-23)9-15-10-22(8-7-17(15)21)18(24)14-5-3-2-4-6-14/h2-6,12-13,15-17H,7-11H2,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | RYQMMKFJDXRJRI-IKGGRYGDSA-N |
| XLogP | 1.51 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |