C21H26F3N5O3 — CID 155852391
1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155852391) has the molecular formula C21H26F3N5O3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852391 |
| Molecular Formula | C21H26F3N5O3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN(C(=O)Cc3ccccc3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N5O.C2HF3O2/c1-22-17(12-24-14-20-13-21-24)10-16-11-23(8-7-18(16)22)19(25)9-15-5-3-2-4-6-15;3-2(4,5)1(6)7/h2-6,13-14,16-18H,7-12H2,1H3;(H,6,7)/t16-,17+,18+;/m1./s1 |
| InChIKey | YOJBAHMNFQOTNS-PWGAQZMISA-N |
| XLogP | 2.08 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |