C16H25N5O2 — CID 97460145
[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 97460145) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is [(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 97460145 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | [(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN(C(=O)[C@@H]3CCCO3)CC[C@@H]21 |
| InChI | InChI=1S/C16H25N5O2/c1-19-13(9-21-11-17-10-18-21)7-12-8-20(5-4-14(12)19)16(22)15-3-2-6-23-15/h10-15H,2-9H2,1H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | UDARFPDYJFNEIJ-QPSCCSFWSA-N |
| XLogP | 0.38 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |