C19H25N5O — CID 97460136
1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone (PubChem CID 97460136) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone.
| Compound Name | 1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 97460136 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-phenylethanone |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN(C(=O)Cc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C19H25N5O/c1-22-17(12-24-14-20-13-21-24)10-16-11-23(8-7-18(16)22)19(25)9-15-5-3-2-4-6-15/h2-6,13-14,16-18H,7-12H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | RPSLGSFLOITPLH-SQNIBIBYSA-N |
| XLogP | 1.44 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |