C18H23N5O2 — CID 133140613
1-[(2R,3aS,7aR)-2-(pyrazol-1-ylmethyl)-5-(1H-pyrrole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 133140613) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(2R,3aS,7aR)-2-(pyrazol-1-ylmethyl)-5-(1H-pyrrole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(2R,3aS,7aR)-2-(pyrazol-1-ylmethyl)-5-(1H-pyrrole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 133140613 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[(2R,3aS,7aR)-2-(pyrazol-1-ylmethyl)-5-(1H-pyrrole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@@H](Cn2cccn2)C[C@H]2CN(C(=O)c3ccc[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C18H23N5O2/c1-13(24)23-15(12-22-8-3-7-20-22)10-14-11-21(9-5-17(14)23)18(25)16-4-2-6-19-16/h2-4,6-8,14-15,17,19H,5,9-12H2,1H3/t14-,15+,17+/m0/s1 |
| InChIKey | MVROLNSUNNXGBU-ZMSDIMECSA-N |
| XLogP | 1.36 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |