C18H22N4O3 — CID 97386880
1-[(2R,3aR,7aS)-5-(furan-2-carbonyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 97386880) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[(2R,3aR,7aS)-5-(furan-2-carbonyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(2R,3aR,7aS)-5-(furan-2-carbonyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 97386880 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[(2R,3aR,7aS)-5-(furan-2-carbonyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@@H](Cn2cccn2)C[C@@H]2CN(C(=O)c3ccco3)CC[C@@H]21 |
| InChI | InChI=1S/C18H22N4O3/c1-13(23)22-15(12-21-7-3-6-19-21)10-14-11-20(8-5-16(14)22)18(24)17-4-2-9-25-17/h2-4,6-7,9,14-16H,5,8,10-12H2,1H3/t14-,15-,16+/m1/s1 |
| InChIKey | HSDMFVXDPJJWKC-OAGGEKHMSA-N |
| XLogP | 1.63 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |