C14H20N6S — CID 97386850
2-[(2S,3aR,7aS)-5-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole (PubChem CID 97386850) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[(2S,3aR,7aS)-5-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole.
| Compound Name | 2-[(2S,3aR,7aS)-5-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 97386850 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[(2S,3aR,7aS)-5-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole |
| SMILES | CN1CC[C@H]2[C@H](C[C@@H](Cn3cncn3)N2c2nccs2)C1 |
| InChI | InChI=1S/C14H20N6S/c1-18-4-2-13-11(7-18)6-12(8-19-10-15-9-17-19)20(13)14-16-3-5-21-14/h3,5,9-13H,2,4,6-8H2,1H3/t11-,12+,13+/m1/s1 |
| InChIKey | GIJPUYYCPNPWHC-AGIUHOORSA-N |
| XLogP | 1.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |