C18H28N4OS — CID 134690373
1-[(2S)-2-(pyrrolidin-1-ylmethyl)-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propan-1-one (PubChem CID 134690373) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-[(2S)-2-(pyrrolidin-1-ylmethyl)-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propan-1-one.
| Compound Name | 1-[(2S)-2-(pyrrolidin-1-ylmethyl)-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 134690373 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(2S)-2-(pyrrolidin-1-ylmethyl)-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2C(C[C@@H](CN3CCCC3)N2c2nccs2)C1 |
| InChI | InChI=1S/C18H28N4OS/c1-2-17(23)21-9-5-16-14(12-21)11-15(13-20-7-3-4-8-20)22(16)18-19-6-10-24-18/h6,10,14-16H,2-5,7-9,11-13H2,1H3/t14?,15-,16?/m0/s1 |
| InChIKey | NWSXEDIZNHEFSL-PCKAHOCUSA-N |
| XLogP | 2.44 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |