C19H26N4OS — CID 124795422
(5aS,9aR)-4-(6-methylpyridazin-3-yl)-8-[(5-methylthiophen-2-yl)methyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine (PubChem CID 124795422) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is (5aS,9aR)-4-(6-methylpyridazin-3-yl)-8-[(5-methylthiophen-2-yl)methyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine.
| Compound Name | (5aS,9aR)-4-(6-methylpyridazin-3-yl)-8-[(5-methylthiophen-2-yl)methyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
|---|---|
| PubChem CID | 124795422 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (5aS,9aR)-4-(6-methylpyridazin-3-yl)-8-[(5-methylthiophen-2-yl)methyl]-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
| SMILES | Cc1ccc(N2CCO[C@H]3CN(Cc4ccc(C)s4)CC[C@H]3C2)nn1 |
| InChI | InChI=1S/C19H26N4OS/c1-14-3-6-19(21-20-14)23-9-10-24-18-13-22(8-7-16(18)11-23)12-17-5-4-15(2)25-17/h3-6,16,18H,7-13H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | BVJKQSGSSUPSAI-WMZOPIPTSA-N |
| XLogP | 2.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |