C18H27N5O2 — CID 134074395
[4-(6-methylpyridazin-3-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-pyrrolidin-1-ylmethanone (PubChem CID 134074395) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is [4-(6-methylpyridazin-3-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(6-methylpyridazin-3-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 134074395 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | [4-(6-methylpyridazin-3-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc(N2CCOC3CN(C(=O)N4CCCC4)CCC3C2)nn1 |
| InChI | InChI=1S/C18H27N5O2/c1-14-4-5-17(20-19-14)22-10-11-25-16-13-23(9-6-15(16)12-22)18(24)21-7-2-3-8-21/h4-5,15-16H,2-3,6-13H2,1H3 |
| InChIKey | WJIZMQWUAJEMMI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |