C15H21FN4O3 — CID 124795603
2-[(2S,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 124795603) has the molecular formula C15H21FN4O3 and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[(2S,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2S,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 124795603 |
| Molecular Formula | C15H21FN4O3 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[(2S,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1C[C@@H]2CN(c3ncc(F)cn3)C[C@@H]2O1 |
| InChI | InChI=1S/C15H21FN4O3/c1-22-3-2-17-14(21)5-12-4-10-8-20(9-13(10)23-12)15-18-6-11(16)7-19-15/h6-7,10,12-13H,2-5,8-9H2,1H3,(H,17,21)/t10-,12+,13+/m1/s1 |
| InChIKey | QEIJGPHUDZLXBQ-WXHSDQCUSA-N |
| XLogP | 0.36 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|