C20H24N4O3 — CID 124796583
[(4R)-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrimidin-4-ylmethanone (PubChem CID 124796583) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is [(4R)-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrimidin-4-ylmethanone.
| Compound Name | [(4R)-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrimidin-4-ylmethanone |
|---|---|
| PubChem CID | 124796583 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(4R)-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrimidin-4-ylmethanone |
| SMILES | O=C(c1ccncn1)N1CCC2(CC1)OCC[C@@H]2CCOc1ccccn1 |
| InChI | InChI=1S/C20H24N4O3/c25-19(17-4-10-21-15-23-17)24-11-7-20(8-12-24)16(6-14-27-20)5-13-26-18-3-1-2-9-22-18/h1-4,9-10,15-16H,5-8,11-14H2/t16-/m0/s1 |
| InChIKey | YJQOQCZJCWPTJZ-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |