C16H24N2O4S — CID 124783917
(4R)-8-methylsulfonyl-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 124783917) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is (4R)-8-methylsulfonyl-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (4R)-8-methylsulfonyl-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 124783917 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (4R)-8-methylsulfonyl-4-(2-pyridin-2-yloxyethyl)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | CS(=O)(=O)N1CCC2(CC1)OCC[C@@H]2CCOc1ccccn1 |
| InChI | InChI=1S/C16H24N2O4S/c1-23(19,20)18-10-7-16(8-11-18)14(6-13-22-16)5-12-21-15-4-2-3-9-17-15/h2-4,9,14H,5-8,10-13H2,1H3/t14-/m0/s1 |
| InChIKey | VSQHMDUGLXJQHN-AWEZNQCLSA-N |
| XLogP | 1.68 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |